C19H18ClNO3 — CID 40578348
prop-2-enyl (2R)-2-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 40578348) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | prop-2-enyl (2R)-2-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 40578348 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | prop-2-enyl (2R)-2-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | C=CCOC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNO3/c1-2-12-24-19(23)17(13-14-8-4-3-5-9-14)21-18(22)15-10-6-7-11-16(15)20/h2-11,17H,1,12-13H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | GIEAXPBAUVVJTB-QGZVFWFLSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|