C13H9ClN4 — CID 40578635
(3S)-2-amino-4-(3-chlorophenyl)but-1-ene-1,1,3-tricarbonitrile (PubChem CID 40578635) has the molecular formula C13H9ClN4 and a molecular weight of 256.70 g/mol. Its IUPAC name is (3S)-2-amino-4-(3-chlorophenyl)but-1-ene-1,1,3-tricarbonitrile.
| Compound Name | (3S)-2-amino-4-(3-chlorophenyl)but-1-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 40578635 |
| Molecular Formula | C13H9ClN4 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (3S)-2-amino-4-(3-chlorophenyl)but-1-ene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)[C@@H](C#N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClN4/c14-12-3-1-2-9(5-12)4-10(6-15)13(18)11(7-16)8-17/h1-3,5,10H,4,18H2/t10-/m1/s1 |
| InChIKey | RIFQOTSUJSGVRK-SNVBAGLBSA-N |
| XLogP | 2.28 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|