C19H14FN5O3S — CID 40579210
N-(4-fluoro-3-nitrophenyl)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide (PubChem CID 40579210) has the molecular formula C19H14FN5O3S and a molecular weight of 411.42 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 40579210 |
| Molecular Formula | C19H14FN5O3S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
| SMILES | Cc1cc2nnc(SCC(=O)Nc3ccc(F)c([N+](=O)[O-])c3)n2c2ccccc12 |
| InChI | InChI=1S/C19H14FN5O3S/c1-11-8-17-22-23-19(24(17)15-5-3-2-4-13(11)15)29-10-18(26)21-12-6-7-14(20)16(9-12)25(27)28/h2-9H,10H2,1H3,(H,21,26) |
| InChIKey | IETGWJZDVSPTOB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|