About 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole
4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole (PubChem CID 4058232) has the molecular formula C33H22N2S2
and a molecular weight of 510.69 g/mol. Its IUPAC name is 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole |
| PubChem CID | 4058232 |
| Molecular Formula | C33H22N2S2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole |
| SMILES | c1ccc2c(c1)Cc1cc(-c3csc(Cc4nc(-c5ccc6c(c5)Cc5ccccc5-6)cs4)n3)ccc1-2 |
| InChI | InChI=1S/C33H22N2S2/c1-3-7-26-20(5-1)13-24-15-22(9-11-28(24)26)30-18-36-32(34-30)17-33-35-31(19-37-33)23-10-12-29-25(16-23)14-21-6-2-4-8-27(21)29/h1-12,15-16,18-19H,13-14,17H2 |
| InChIKey | BIRXBVRBBYSSAI-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole?
The IUPAC name of 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole (CID 4058232) is 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole.
What is the SMILES notation for 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole?
The canonical SMILES for 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole is c1ccc2c(c1)Cc1cc(-c3csc(Cc4nc(-c5ccc6c(c5)Cc5ccccc5-6)cs4)n3)ccc1-2.
What is the InChIKey of 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole?
The InChIKey is BIRXBVRBBYSSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22N2S2/c1-3-7-26-20(5-1)13-24-15-22(9-11-28(24)26)30-18-36-32(34-30)17-33-35-31(19-37-33)23-10-12-29-25(16-23)14-21-6-2-4-8-27(21)29/h1-12,15-16,18-19H,13-14,17H2.
What are the key properties of 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole?
4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole has a molecular weight of 510.69 g/mol, XLogP of 8.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9H-fluoren-2-yl)-2-[[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]methyl]-1,3-thiazole is sourced from PubChem (CID 4058232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).