C26H38N2O5 — CID 40586327
[(1R,2R,4aR,5S,6R,8aR)-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-phenylcarbamate (PubChem CID 40586327) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(1R,2R,4aR,5S,6R,8aR)-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-phenylcarbamate.
| Compound Name | [(1R,2R,4aR,5S,6R,8aR)-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 40586327 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | [(1R,2R,4aR,5S,6R,8aR)-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-phenylcarbamate |
| SMILES | C[C@]1(CO)[C@@H]2CC[C@@H](O)[C@@H](CC(=O)N3CCCC3)[C@]2(C)CC[C@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H38N2O5/c1-25-13-12-22(33-24(32)27-18-8-4-3-5-9-18)26(2,17-29)21(25)11-10-20(30)19(25)16-23(31)28-14-6-7-15-28/h3-5,8-9,19-22,29-30H,6-7,10-17H2,1-2H3,(H,27,32)/t19-,20-,21-,22-,25+,26+/m1/s1 |
| InChIKey | FTBMITBIGOFQOS-RUNZLFIYSA-N |
| XLogP | 3.80 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |