C18H19N3O2S — CID 4058644
5-[(3,4-dimethylphenoxy)methyl]-2-(hydroxymethyl)-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 4058644) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenoxy)methyl]-2-(hydroxymethyl)-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-[(3,4-dimethylphenoxy)methyl]-2-(hydroxymethyl)-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 4058644 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-[(3,4-dimethylphenoxy)methyl]-2-(hydroxymethyl)-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(OCc2nn(CO)c(=S)n2-c2ccccc2)cc1C |
| InChI | InChI=1S/C18H19N3O2S/c1-13-8-9-16(10-14(13)2)23-11-17-19-20(12-22)18(24)21(17)15-6-4-3-5-7-15/h3-10,22H,11-12H2,1-2H3 |
| InChIKey | VVXSICCCDCDKSN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|