About 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide
1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide (PubChem CID 4058881) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide |
| PubChem CID | 4058881 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide |
| SMILES | COC(CNC(=O)c1ccc2c(c1)ncn2C1CCCCCC1)OC |
| InChI | InChI=1S/C19H27N3O3/c1-24-18(25-2)12-20-19(23)14-9-10-17-16(11-14)21-13-22(17)15-7-5-3-4-6-8-15/h9-11,13,15,18H,3-8,12H2,1-2H3,(H,20,23) |
| InChIKey | SXWYWXWXCPHZTE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide?
The IUPAC name of 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide (CID 4058881) is 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide.
What is the SMILES notation for 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide?
The canonical SMILES for 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide is COC(CNC(=O)c1ccc2c(c1)ncn2C1CCCCCC1)OC.
What is the InChIKey of 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide?
The InChIKey is SXWYWXWXCPHZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-24-18(25-2)12-20-19(23)14-9-10-17-16(11-14)21-13-22(17)15-7-5-3-4-6-8-15/h9-11,13,15,18H,3-8,12H2,1-2H3,(H,20,23).
What are the key properties of 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide?
1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide has a molecular weight of 345.44 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-N-(2,2-dimethoxyethyl)benzimidazole-5-carboxamide is sourced from PubChem (CID 4058881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).