About 2-dodecylsulfanyl-1,3-benzothiazole
2-dodecylsulfanyl-1,3-benzothiazole (PubChem CID 4059537) has the molecular formula C19H29NS2
and a molecular weight of 335.58 g/mol. Its IUPAC name is 2-dodecylsulfanyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-dodecylsulfanyl-1,3-benzothiazole |
| PubChem CID | 4059537 |
| Molecular Formula | C19H29NS2 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-dodecylsulfanyl-1,3-benzothiazole |
| SMILES | CCCCCCCCCCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H29NS2/c1-2-3-4-5-6-7-8-9-10-13-16-21-19-20-17-14-11-12-15-18(17)22-19/h11-12,14-15H,2-10,13,16H2,1H3 |
| InChIKey | ZJCGCYWSOGPALF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecylsulfanyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecylsulfanyl-1,3-benzothiazole?
The IUPAC name of 2-dodecylsulfanyl-1,3-benzothiazole (CID 4059537) is 2-dodecylsulfanyl-1,3-benzothiazole.
What is the SMILES notation for 2-dodecylsulfanyl-1,3-benzothiazole?
The canonical SMILES for 2-dodecylsulfanyl-1,3-benzothiazole is CCCCCCCCCCCCSc1nc2ccccc2s1.
What is the InChIKey of 2-dodecylsulfanyl-1,3-benzothiazole?
The InChIKey is ZJCGCYWSOGPALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NS2/c1-2-3-4-5-6-7-8-9-10-13-16-21-19-20-17-14-11-12-15-18(17)22-19/h11-12,14-15H,2-10,13,16H2,1H3.
What are the key properties of 2-dodecylsulfanyl-1,3-benzothiazole?
2-dodecylsulfanyl-1,3-benzothiazole has a molecular weight of 335.58 g/mol, XLogP of 7.31, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecylsulfanyl-1,3-benzothiazole is sourced from PubChem (CID 4059537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).