C22H23BrN2O6 — CID 40597802
2-phenoxyethyl (4R)-4-(2-bromo-4,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 40597802) has the molecular formula C22H23BrN2O6 and a molecular weight of 491.34 g/mol. Its IUPAC name is 2-phenoxyethyl (4R)-4-(2-bromo-4,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-phenoxyethyl (4R)-4-(2-bromo-4,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 40597802 |
| Molecular Formula | C22H23BrN2O6 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-phenoxyethyl (4R)-4-(2-bromo-4,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COc1cc(Br)c([C@@H]2NC(=O)NC(C)=C2C(=O)OCCOc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H23BrN2O6/c1-13-19(21(26)31-10-9-30-14-7-5-4-6-8-14)20(25-22(27)24-13)15-11-17(28-2)18(29-3)12-16(15)23/h4-8,11-12,20H,9-10H2,1-3H3,(H2,24,25,27)/t20-/m0/s1 |
| InChIKey | ITJSUHHBBCRTLQ-FQEVSTJZSA-N |
| XLogP | 3.72 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|