C22H25F3N2O3 — CID 40598598
4-[(2S)-butan-2-yl]oxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 40598598) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]oxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(2S)-butan-2-yl]oxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 40598598 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-[(2S)-butan-2-yl]oxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC[C@H](C)Oc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25F3N2O3/c1-3-15(2)30-18-7-4-16(5-8-18)21(28)26-19-14-17(22(23,24)25)6-9-20(19)27-10-12-29-13-11-27/h4-9,14-15H,3,10-13H2,1-2H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | SGLIZSWRCKUTKI-HNNXBMFYSA-N |
| XLogP | 4.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |