About 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea
1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea (PubChem CID 40600200) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea |
| PubChem CID | 40600200 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea |
| SMILES | O=C(NC[C@H](O)CO)NC1CCCCC1 |
| InChI | InChI=1S/C10H20N2O3/c13-7-9(14)6-11-10(15)12-8-4-2-1-3-5-8/h8-9,13-14H,1-7H2,(H2,11,12,15)/t9-/m0/s1 |
| InChIKey | HYYGOKJQEVGLFG-VIFPVBQESA-N |
| XLogP | -0.03 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea?
The IUPAC name of 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea (CID 40600200) is 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea.
What is the SMILES notation for 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea?
The canonical SMILES for 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea is O=C(NC[C@H](O)CO)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea?
The InChIKey is HYYGOKJQEVGLFG-VIFPVBQESA-N. The full InChI is InChI=1S/C10H20N2O3/c13-7-9(14)6-11-10(15)12-8-4-2-1-3-5-8/h8-9,13-14H,1-7H2,(H2,11,12,15)/t9-/m0/s1.
What are the key properties of 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea?
1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea has a molecular weight of 216.28 g/mol, XLogP of -0.03, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[(2S)-2,3-dihydroxypropyl]urea is sourced from PubChem (CID 40600200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).