About (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one
(4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one (PubChem CID 40600379) has the molecular formula C16H19Cl2N3O
and a molecular weight of 340.25 g/mol. Its IUPAC name is (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one |
| PubChem CID | 40600379 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(Cl)c(Cl)c2)C(=O)[C@H]1CN1CCCCC1 |
| InChI | InChI=1S/C16H19Cl2N3O/c1-11-13(10-20-7-3-2-4-8-20)16(22)21(19-11)12-5-6-14(17)15(18)9-12/h5-6,9,13H,2-4,7-8,10H2,1H3/t13-/m0/s1 |
| InChIKey | WDOOSDNCIQQEMX-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one?
The IUPAC name of (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one (CID 40600379) is (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one.
What is the SMILES notation for (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one?
The canonical SMILES for (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one is CC1=NN(c2ccc(Cl)c(Cl)c2)C(=O)[C@H]1CN1CCCCC1.
What is the InChIKey of (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one?
The InChIKey is WDOOSDNCIQQEMX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H19Cl2N3O/c1-11-13(10-20-7-3-2-4-8-20)16(22)21(19-11)12-5-6-14(17)15(18)9-12/h5-6,9,13H,2-4,7-8,10H2,1H3/t13-/m0/s1.
What are the key properties of (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one?
(4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one has a molecular weight of 340.25 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-(3,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylmethyl)-4H-pyrazol-3-one is sourced from PubChem (CID 40600379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).