C18H18Cl2N2O4 — CID 40600726
(4-chlorophenyl)methyl N-[[(2S)-2-(4-chloro-3-methylphenoxy)propanoyl]amino]carbamate (PubChem CID 40600726) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N-[[(2S)-2-(4-chloro-3-methylphenoxy)propanoyl]amino]carbamate.
| Compound Name | (4-chlorophenyl)methyl N-[[(2S)-2-(4-chloro-3-methylphenoxy)propanoyl]amino]carbamate |
|---|---|
| PubChem CID | 40600726 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (4-chlorophenyl)methyl N-[[(2S)-2-(4-chloro-3-methylphenoxy)propanoyl]amino]carbamate |
| SMILES | Cc1cc(O[C@@H](C)C(=O)NNC(=O)OCc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-11-9-15(7-8-16(11)20)26-12(2)17(23)21-22-18(24)25-10-13-3-5-14(19)6-4-13/h3-9,12H,10H2,1-2H3,(H,21,23)(H,22,24)/t12-/m0/s1 |
| InChIKey | RJOLSQHHYYZQLQ-LBPRGKRZSA-N |
| XLogP | 4.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|