C22H21N6O6- — CID 4060139
2-ethoxy-4-[6-[(2-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-6-nitrophenolate (PubChem CID 4060139) has the molecular formula C22H21N6O6- and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-ethoxy-4-[6-[(2-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-6-nitrophenolate.
| Compound Name | 2-ethoxy-4-[6-[(2-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-6-nitrophenolate |
|---|---|
| PubChem CID | 4060139 |
| Molecular Formula | C22H21N6O6- |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-ethoxy-4-[6-[(2-methoxyphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-6-nitrophenolate |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3OC)=C(C)Nc3ncnn32)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C22H22N6O6/c1-4-34-17-10-13(9-15(20(17)29)28(31)32)19-18(12(2)25-22-23-11-24-27(19)22)21(30)26-14-7-5-6-8-16(14)33-3/h5-11,19,29H,4H2,1-3H3,(H,26,30)(H,23,24,25)/p-1 |
| InChIKey | FOSFXGAXRZJFNE-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|