C20H22N2O4 — CID 40602528
(3R)-1-benzyl-N-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 40602528) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3R)-1-benzyl-N-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-benzyl-N-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40602528 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3R)-1-benzyl-N-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC(=O)N(Cc3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-16-8-9-17(18(11-16)26-2)21-20(24)15-10-19(23)22(13-15)12-14-6-4-3-5-7-14/h3-9,11,15H,10,12-13H2,1-2H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | YDXHNZDAGVZUDZ-OAHLLOKOSA-N |
| XLogP | 2.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |