C16H26N2O3S — CID 40603483
(2R)-N-tert-butyl-2-(3,4-dimethyl-N-methylsulfonylanilino)propanamide (PubChem CID 40603483) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-(3,4-dimethyl-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-tert-butyl-2-(3,4-dimethyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 40603483 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2R)-N-tert-butyl-2-(3,4-dimethyl-N-methylsulfonylanilino)propanamide |
| SMILES | Cc1ccc(N([C@H](C)C(=O)NC(C)(C)C)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C16H26N2O3S/c1-11-8-9-14(10-12(11)2)18(22(7,20)21)13(3)15(19)17-16(4,5)6/h8-10,13H,1-7H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | SNDBSGBMAUWKMC-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |