C24H28N2O3S — CID 40604077
benzyl (4S)-6-methyl-4-[4-(3-methylbutoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 40604077) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is benzyl (4S)-6-methyl-4-[4-(3-methylbutoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl (4S)-6-methyl-4-[4-(3-methylbutoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 40604077 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | benzyl (4S)-6-methyl-4-[4-(3-methylbutoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@H](c2ccc(OCCC(C)C)cc2)NC(=S)N1 |
| InChI | InChI=1S/C24H28N2O3S/c1-16(2)13-14-28-20-11-9-19(10-12-20)22-21(17(3)25-24(30)26-22)23(27)29-15-18-7-5-4-6-8-18/h4-12,16,22H,13-15H2,1-3H3,(H2,25,26,30)/t22-/m0/s1 |
| InChIKey | YBDYBKHVBHTHOF-QFIPXVFZSA-N |
| XLogP | 4.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|