C20H23NO2 — CID 40606245
N-cyclohexyl-4-(phenoxymethyl)benzamide (PubChem CID 40606245) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-cyclohexyl-4-(phenoxymethyl)benzamide.
| Compound Name | N-cyclohexyl-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 40606245 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-cyclohexyl-4-(phenoxymethyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO2/c22-20(21-18-7-3-1-4-8-18)17-13-11-16(12-14-17)15-23-19-9-5-2-6-10-19/h2,5-6,9-14,18H,1,3-4,7-8,15H2,(H,21,22) |
| InChIKey | KQUFJTUBSSQZAR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |