About methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate
methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate (PubChem CID 4060756) has the molecular formula C8H6N2O3S
and a molecular weight of 210.21 g/mol. Its IUPAC name is methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate |
| PubChem CID | 4060756 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate |
| SMILES | COC(=O)c1cc(=O)nc(CC#N)s1 |
| InChI | InChI=1S/C8H6N2O3S/c1-13-8(12)5-4-6(11)10-7(14-5)2-3-9/h4H,2H2,1H3 |
| InChIKey | VQSKQHKAMSDWBN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate?
The IUPAC name of methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate (CID 4060756) is methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate.
What is the SMILES notation for methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate?
The canonical SMILES for methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate is COC(=O)c1cc(=O)nc(CC#N)s1.
What is the InChIKey of methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate?
The InChIKey is VQSKQHKAMSDWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c1-13-8(12)5-4-6(11)10-7(14-5)2-3-9/h4H,2H2,1H3.
What are the key properties of methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate?
methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate has a molecular weight of 210.21 g/mol, XLogP of 0.36, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(cyanomethyl)-4-oxo-1,3-thiazine-6-carboxylate is sourced from PubChem (CID 4060756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).