About 1,9-dibromo-2,8-dimethoxydibenzofuran
1,9-dibromo-2,8-dimethoxydibenzofuran (PubChem CID 4060876) has the molecular formula C14H10Br2O3
and a molecular weight of 386.04 g/mol. Its IUPAC name is 1,9-dibromo-2,8-dimethoxydibenzofuran.
Molecular Properties
| Compound Name | 1,9-dibromo-2,8-dimethoxydibenzofuran |
| PubChem CID | 4060876 |
| Molecular Formula | C14H10Br2O3 |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 1,9-dibromo-2,8-dimethoxydibenzofuran |
| SMILES | COc1ccc2oc3ccc(OC)c(Br)c3c2c1Br |
| InChI | InChI=1S/C14H10Br2O3/c1-17-9-5-3-7-11(13(9)15)12-8(19-7)4-6-10(18-2)14(12)16/h3-6H,1-2H3 |
| InChIKey | MNHOLBJNRVWNRV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,9-dibromo-2,8-dimethoxydibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-dibromo-2,8-dimethoxydibenzofuran?
The IUPAC name of 1,9-dibromo-2,8-dimethoxydibenzofuran (CID 4060876) is 1,9-dibromo-2,8-dimethoxydibenzofuran.
What is the SMILES notation for 1,9-dibromo-2,8-dimethoxydibenzofuran?
The canonical SMILES for 1,9-dibromo-2,8-dimethoxydibenzofuran is COc1ccc2oc3ccc(OC)c(Br)c3c2c1Br.
What is the InChIKey of 1,9-dibromo-2,8-dimethoxydibenzofuran?
The InChIKey is MNHOLBJNRVWNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br2O3/c1-17-9-5-3-7-11(13(9)15)12-8(19-7)4-6-10(18-2)14(12)16/h3-6H,1-2H3.
What are the key properties of 1,9-dibromo-2,8-dimethoxydibenzofuran?
1,9-dibromo-2,8-dimethoxydibenzofuran has a molecular weight of 386.04 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-dibromo-2,8-dimethoxydibenzofuran is sourced from PubChem (CID 4060876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).