C25H24N2O4 — CID 40609025
N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-9H-xanthene-9-carboxamide (PubChem CID 40609025) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 40609025 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-9H-xanthene-9-carboxamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H24N2O4/c1-3-27(16-23(28)26-17-9-8-10-18(15-17)30-2)25(29)24-19-11-4-6-13-21(19)31-22-14-7-5-12-20(22)24/h4-15,24H,3,16H2,1-2H3,(H,26,28) |
| InChIKey | KGTXDFVDMAQVHJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |