C11H14N4O4S2 — CID 40611074
8-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 40611074) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 8-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 40611074 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 8-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(S[C@H]3CCS(=O)(=O)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C11H14N4O4S2/c1-14-8-7(9(16)15(2)11(14)17)12-10(13-8)20-6-3-4-21(18,19)5-6/h6H,3-5H2,1-2H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | IIDPKYCYPFMYEZ-LURJTMIESA-N |
| XLogP | -0.76 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |