About 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid
3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid (PubChem CID 4061203) has the molecular formula C11H14Cl2O3Te
and a molecular weight of 392.74 g/mol. Its IUPAC name is 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid |
| PubChem CID | 4061203 |
| Molecular Formula | C11H14Cl2O3Te |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid |
| SMILES | CCOc1ccc([Te](Cl)(Cl)CCC(=O)O)cc1 |
| InChI | InChI=1S/C11H14Cl2O3Te/c1-2-16-9-3-5-10(6-4-9)17(12,13)8-7-11(14)15/h3-6H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | PGNMMPQJWJVDDQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid?
The IUPAC name of 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid (CID 4061203) is 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid.
What is the SMILES notation for 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid?
The canonical SMILES for 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid is CCOc1ccc([Te](Cl)(Cl)CCC(=O)O)cc1.
What is the InChIKey of 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid?
The InChIKey is PGNMMPQJWJVDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2O3Te/c1-2-16-9-3-5-10(6-4-9)17(12,13)8-7-11(14)15/h3-6H,2,7-8H2,1H3,(H,14,15).
What are the key properties of 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid?
3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid has a molecular weight of 392.74 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dichloro-(4-ethoxyphenyl)-λ4-tellanyl]propanoic acid is sourced from PubChem (CID 4061203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).