C19H15FN2O3S — CID 40612351
methyl 2-[4-fluoro-2-[(E)-3-phenylprop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 40612351) has the molecular formula C19H15FN2O3S and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[4-fluoro-2-[(E)-3-phenylprop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4-fluoro-2-[(E)-3-phenylprop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40612351 |
| Molecular Formula | C19H15FN2O3S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | methyl 2-[4-fluoro-2-[(E)-3-phenylprop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)/C=C/c2ccccc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C19H15FN2O3S/c1-25-17(24)12-22-18-14(20)8-5-9-15(18)26-19(22)21-16(23)11-10-13-6-3-2-4-7-13/h2-11H,12H2,1H3/b11-10+,21-19- |
| InChIKey | RECVNTCLDRAXKZ-VGNAVFDMSA-N |
| XLogP | 3.16 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|