C21H15BrN6O4 — CID 4061341
6-(4-bromophenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 4061341) has the molecular formula C21H15BrN6O4 and a molecular weight of 495.29 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(4-bromophenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 4061341 |
| Molecular Formula | C21H15BrN6O4 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 6-(4-bromophenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(=O)c2c(nc3n(-c4ccc(Br)cc4)c(-c4cccc([N+](=O)[O-])c4)cn23)n(C)c1=O |
| InChI | InChI=1S/C21H15BrN6O4/c1-24-18-17(19(29)25(2)21(24)30)26-11-16(12-4-3-5-15(10-12)28(31)32)27(20(26)23-18)14-8-6-13(22)7-9-14/h3-11H,1-2H3 |
| InChIKey | ORBVTNIDEBJXCI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|