C15H12N4O5S — CID 40618217
(4R,5R)-9-naphthalen-1-ylsulfonyl-3,4,5,7-tetrahydropurine-2,6,8-trione (PubChem CID 40618217) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is (4R,5R)-9-naphthalen-1-ylsulfonyl-3,4,5,7-tetrahydropurine-2,6,8-trione.
| Compound Name | (4R,5R)-9-naphthalen-1-ylsulfonyl-3,4,5,7-tetrahydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 40618217 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (4R,5R)-9-naphthalen-1-ylsulfonyl-3,4,5,7-tetrahydropurine-2,6,8-trione |
| SMILES | O=C1NC(=O)[C@@H]2NC(=O)N(S(=O)(=O)c3cccc4ccccc34)[C@H]2N1 |
| InChI | InChI=1S/C15H12N4O5S/c20-13-11-12(17-14(21)18-13)19(15(22)16-11)25(23,24)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11-12H,(H,16,22)(H2,17,18,20,21)/t11-,12-/m1/s1 |
| InChIKey | AFOOKWOVMKSLSA-VXGBXAGGSA-N |
| XLogP | 0.09 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |