C25H35N5O4S — CID 40618491
4-amino-5-N-(4-butoxyphenyl)-5-N-[(2S)-1-(cyclopentylamino)-1-oxopentan-2-yl]-1,2-thiazole-3,5-dicarboxamide (PubChem CID 40618491) has the molecular formula C25H35N5O4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 4-amino-5-N-(4-butoxyphenyl)-5-N-[(2S)-1-(cyclopentylamino)-1-oxopentan-2-yl]-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-(4-butoxyphenyl)-5-N-[(2S)-1-(cyclopentylamino)-1-oxopentan-2-yl]-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 40618491 |
| Molecular Formula | C25H35N5O4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-amino-5-N-(4-butoxyphenyl)-5-N-[(2S)-1-(cyclopentylamino)-1-oxopentan-2-yl]-1,2-thiazole-3,5-dicarboxamide |
| SMILES | CCCCOc1ccc(N(C(=O)c2snc(C(N)=O)c2N)[C@@H](CCC)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C25H35N5O4S/c1-3-5-15-34-18-13-11-17(12-14-18)30(25(33)22-20(26)21(23(27)31)29-35-22)19(8-4-2)24(32)28-16-9-6-7-10-16/h11-14,16,19H,3-10,15,26H2,1-2H3,(H2,27,31)(H,28,32)/t19-/m0/s1 |
| InChIKey | OWDQBECBOACWJW-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|