C19H28N4O5 — CID 40619024
(2S,3R)-3-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamoyl]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 40619024) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2S,3R)-3-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamoyl]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamoyl]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 40619024 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2S,3R)-3-[[1-ethyl-3-(2-methoxyethylcarbamoyl)pyrazol-4-yl]carbamoyl]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | CCn1cc(NC(=O)[C@@H]2C3CCC(CC3)[C@@H]2C(=O)O)c(C(=O)NCCOC)n1 |
| InChI | InChI=1S/C19H28N4O5/c1-3-23-10-13(16(22-23)18(25)20-8-9-28-2)21-17(24)14-11-4-6-12(7-5-11)15(14)19(26)27/h10-12,14-15H,3-9H2,1-2H3,(H,20,25)(H,21,24)(H,26,27)/t11?,12?,14-,15+/m1/s1 |
| InChIKey | YNKDNGDVHLNPGR-VHMBPLKRSA-N |
| XLogP | 1.35 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|