C12H17N5O2 — CID 40627318
(1S,2R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclohexan-1-ol (PubChem CID 40627318) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is (1S,2R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | (1S,2R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 40627318 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (1S,2R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclohexan-1-ol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@H](CO)[C@@H](O)C1 |
| InChI | InChI=1S/C12H17N5O2/c13-11-10-12(15-5-14-11)17(6-16-10)8-2-1-7(4-18)9(19)3-8/h5-9,18-19H,1-4H2,(H2,13,14,15)/t7-,8+,9+/m1/s1 |
| InChIKey | QZEHMNCVKZWEHI-VGMNWLOBSA-N |
| XLogP | 0.10 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |