C17H19N3O3S2 — CID 40628567
4-[(2R)-butan-2-yl]oxy-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide (PubChem CID 40628567) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]oxy-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide.
| Compound Name | 4-[(2R)-butan-2-yl]oxy-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 40628567 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-[(2R)-butan-2-yl]oxy-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide |
| SMILES | CC[C@@H](C)Oc1ccc(C(=O)NC(=S)NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-3-11(2)23-13-8-6-12(7-9-13)15(21)18-17(24)20-19-16(22)14-5-4-10-25-14/h4-11H,3H2,1-2H3,(H,19,22)(H2,18,20,21,24)/t11-/m1/s1 |
| InChIKey | PASAJGIOZMADGD-LLVKDONJSA-N |
| XLogP | 2.87 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|