C20H22ClN2O+ — CID 40630793
(2R)-1-(4-chlorophenyl)-2-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 40630793) has the molecular formula C20H22ClN2O+ and a molecular weight of 341.86 g/mol. Its IUPAC name is (2R)-1-(4-chlorophenyl)-2-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | (2R)-1-(4-chlorophenyl)-2-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 40630793 |
| Molecular Formula | C20H22ClN2O+ |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-1-(4-chlorophenyl)-2-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | O[C@]1(c2ccccc2)C[N+]2=C(CCCCC2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN2O/c21-17-10-12-18(13-11-17)23-19-9-5-2-6-14-22(19)15-20(23,24)16-7-3-1-4-8-16/h1,3-4,7-8,10-13,24H,2,5-6,9,14-15H2/q+1/t20-/m0/s1 |
| InChIKey | MELDCHYPEUNVCK-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|