C23H26N4OS — CID 4063139
1-[2-(3-methylphenyl)ethyl]-3-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)thiourea (PubChem CID 4063139) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)ethyl]-3-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)thiourea.
| Compound Name | 1-[2-(3-methylphenyl)ethyl]-3-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)thiourea |
|---|---|
| PubChem CID | 4063139 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[2-(3-methylphenyl)ethyl]-3-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)thiourea |
| SMILES | Cc1cccc(CCNC(=S)Nc2ccc3nc4n(c(=O)c3c2)CCCCC4)c1 |
| InChI | InChI=1S/C23H26N4OS/c1-16-6-5-7-17(14-16)11-12-24-23(29)25-18-9-10-20-19(15-18)22(28)27-13-4-2-3-8-21(27)26-20/h5-7,9-10,14-15H,2-4,8,11-13H2,1H3,(H2,24,25,29) |
| InChIKey | RUZBRMWGEIRKHO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|