C16H17Cl2N3O — CID 40634361
(4S)-4-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one (PubChem CID 40634361) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is (4S)-4-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one.
| Compound Name | (4S)-4-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 40634361 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (4S)-4-[1-[[(1R)-2,2-dichlorocyclopropyl]methyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one |
| SMILES | CN1C[C@@H](c2nc3ccccc3n2C[C@H]2CC2(Cl)Cl)CC1=O |
| InChI | InChI=1S/C16H17Cl2N3O/c1-20-8-10(6-14(20)22)15-19-12-4-2-3-5-13(12)21(15)9-11-7-16(11,17)18/h2-5,10-11H,6-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | OSNYFNSKXQCIQW-WDEREUQCSA-N |
| XLogP | 3.18 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|