C17H20N2O4S — CID 4063478
prop-2-enyl 6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 4063478) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is prop-2-enyl 6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | prop-2-enyl 6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 4063478 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | prop-2-enyl 6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | C=CCOC(=O)C1C2NC(=S)NC1(C)Oc1c(OCC)cccc12 |
| InChI | InChI=1S/C17H20N2O4S/c1-4-9-22-15(20)12-13-10-7-6-8-11(21-5-2)14(10)23-17(12,3)19-16(24)18-13/h4,6-8,12-13H,1,5,9H2,2-3H3,(H2,18,19,24) |
| InChIKey | VHBRMZAUDAXZCD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|