C13H19NO2 — CID 40636094
N-[(1S)-1-(3-methoxyphenyl)ethyl]butanamide (PubChem CID 40636094) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[(1S)-1-(3-methoxyphenyl)ethyl]butanamide.
| Compound Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 40636094 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](C)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H19NO2/c1-4-6-13(15)14-10(2)11-7-5-8-12(9-11)16-3/h5,7-10H,4,6H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | BYRQUCGLELHWHG-JTQLQIEISA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |