C15H23ClN2O — CID 40636276
1,1-bis[(2S)-butan-2-yl]-3-(3-chlorophenyl)urea (PubChem CID 40636276) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 1,1-bis[(2S)-butan-2-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1,1-bis[(2S)-butan-2-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 40636276 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1,1-bis[(2S)-butan-2-yl]-3-(3-chlorophenyl)urea |
| SMILES | CC[C@H](C)N(C(=O)Nc1cccc(Cl)c1)[C@@H](C)CC |
| InChI | InChI=1S/C15H23ClN2O/c1-5-11(3)18(12(4)6-2)15(19)17-14-9-7-8-13(16)10-14/h7-12H,5-6H2,1-4H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | REKVKNVVMCDMRK-RYUDHWBXSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |