C11H9Cl2N3S — CID 40636976
3-cyclopropyl-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 40636976) has the molecular formula C11H9Cl2N3S and a molecular weight of 286.19 g/mol. Its IUPAC name is 3-cyclopropyl-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 40636976 |
| Molecular Formula | C11H9Cl2N3S |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 3-cyclopropyl-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(C2CC2)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3S/c12-8-4-3-7(5-9(8)13)16-10(6-1-2-6)14-15-11(16)17/h3-6H,1-2H2,(H,15,17) |
| InChIKey | JVXFZQSSGQJMKC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|