C20H19NO5 — CID 40640305
(2R)-2-ethyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]-1,4-benzoxazepine-3,5-dione (PubChem CID 40640305) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (2R)-2-ethyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]-1,4-benzoxazepine-3,5-dione.
| Compound Name | (2R)-2-ethyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]-1,4-benzoxazepine-3,5-dione |
|---|---|
| PubChem CID | 40640305 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2R)-2-ethyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]-1,4-benzoxazepine-3,5-dione |
| SMILES | CC[C@H]1Oc2ccccc2C(=O)N(CC(=O)c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C20H19NO5/c1-3-17-20(24)21(19(23)15-9-4-5-10-18(15)26-17)12-16(22)13-7-6-8-14(11-13)25-2/h4-11,17H,3,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | SSNPGPMHWXVOJA-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|