C17H17BrCl2NO3P — CID 40640755
N-[(R)-(4-bromophenyl)-[(2S,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]-3,5-dichloroaniline (PubChem CID 40640755) has the molecular formula C17H17BrCl2NO3P and a molecular weight of 465.11 g/mol. Its IUPAC name is N-[(R)-(4-bromophenyl)-[(2S,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]-3,5-dichloroaniline.
| Compound Name | N-[(R)-(4-bromophenyl)-[(2S,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]-3,5-dichloroaniline |
|---|---|
| PubChem CID | 40640755 |
| Molecular Formula | C17H17BrCl2NO3P |
| Molecular Weight | 465.11 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | N-[(R)-(4-bromophenyl)-[(2S,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]-3,5-dichloroaniline |
| SMILES | C[C@H]1CCO[P@@](=O)([C@@H](Nc2cc(Cl)cc(Cl)c2)c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C17H17BrCl2NO3P/c1-11-6-7-23-25(22,24-11)17(12-2-4-13(18)5-3-12)21-16-9-14(19)8-15(20)10-16/h2-5,8-11,17,21H,6-7H2,1H3/t11-,17+,25-/m0/s1 |
| InChIKey | FHLHPLJVGYWYMP-FVXWZUAVSA-N |
| XLogP | 6.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.11 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|