C20H20N2O4S — CID 4064215
2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol (PubChem CID 4064215) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 4064215 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc4c(c3)OCCO4)n2CCO)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-24-16-5-3-15(4-6-16)21-20-22(8-9-23)17(13-27-20)14-2-7-18-19(12-14)26-11-10-25-18/h2-7,12-13,23H,8-11H2,1H3/b21-20- |
| InChIKey | FKJFLOMHZRRMEB-MRCUWXFGSA-N |
| XLogP | 3.22 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|