C22H31N3O4S2 — CID 4064303
N-cycloheptyl-2-(3-oxo-6-piperidin-1-ylsulfonyl-1,4-benzothiazin-4-yl)acetamide (PubChem CID 4064303) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-cycloheptyl-2-(3-oxo-6-piperidin-1-ylsulfonyl-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(3-oxo-6-piperidin-1-ylsulfonyl-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 4064303 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-cycloheptyl-2-(3-oxo-6-piperidin-1-ylsulfonyl-1,4-benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccc(S(=O)(=O)N3CCCCC3)cc21)NC1CCCCCC1 |
| InChI | InChI=1S/C22H31N3O4S2/c26-21(23-17-8-4-1-2-5-9-17)15-25-19-14-18(10-11-20(19)30-16-22(25)27)31(28,29)24-12-6-3-7-13-24/h10-11,14,17H,1-9,12-13,15-16H2,(H,23,26) |
| InChIKey | SIWQQMLSXYDSLH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |