C20H21N5OS — CID 40643953
(6R,7S)-3-ethyl-6-(4-methylphenyl)-N-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 40643953) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (6R,7S)-3-ethyl-6-(4-methylphenyl)-N-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6R,7S)-3-ethyl-6-(4-methylphenyl)-N-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 40643953 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (6R,7S)-3-ethyl-6-(4-methylphenyl)-N-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCc1nnc2n1N[C@H](c1ccc(C)cc1)[C@@H](C(=O)Nc1ccccc1)S2 |
| InChI | InChI=1S/C20H21N5OS/c1-3-16-22-23-20-25(16)24-17(14-11-9-13(2)10-12-14)18(27-20)19(26)21-15-7-5-4-6-8-15/h4-12,17-18,24H,3H2,1-2H3,(H,21,26)/t17-,18+/m1/s1 |
| InChIKey | KZYPNKNBSNGJDH-MSOLQXFVSA-N |
| XLogP | 3.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |