4-methoxyimino-4-thiophen-2-ylbutanoic acid

C9H11NO3S — CID 4064427

IUPAC4-methoxyimino-4-thiophen-2-ylbutanoic acid
SMILESCON=C(CCC(=O)O)c1cccs1
InChIInChI=1S/C9H11NO3S/c1-13-10-7(4-5-9(11)12)8-3-2-6-14-8/h2-3,6H,4-5H2,1H3,(H,11,12)
InChIKeyHQDSHTLDFCGASD-UHFFFAOYSA-N
MW213.26 g/mol
LogP1.96
Rot. Bonds5

About 4-methoxyimino-4-thiophen-2-ylbutanoic acid

4-methoxyimino-4-thiophen-2-ylbutanoic acid (PubChem CID 4064427) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 4-methoxyimino-4-thiophen-2-ylbutanoic acid.

Molecular Properties

Compound Name4-methoxyimino-4-thiophen-2-ylbutanoic acid
PubChem CID4064427
Molecular FormulaC9H11NO3S
Molecular Weight213.26 g/mol
Exact Mass213.05
IUPAC Name4-methoxyimino-4-thiophen-2-ylbutanoic acid
SMILESCON=C(CCC(=O)O)c1cccs1
InChIInChI=1S/C9H11NO3S/c1-13-10-7(4-5-9(11)12)8-3-2-6-14-8/h2-3,6H,4-5H2,1H3,(H,11,12)
InChIKeyHQDSHTLDFCGASD-UHFFFAOYSA-N
XLogP1.96
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.26
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-methoxyimino-4-thiophen-2-ylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxyimino-4-thiophen-2-ylbutanoic acid?
The IUPAC name of 4-methoxyimino-4-thiophen-2-ylbutanoic acid (CID 4064427) is 4-methoxyimino-4-thiophen-2-ylbutanoic acid.
What is the SMILES notation for 4-methoxyimino-4-thiophen-2-ylbutanoic acid?
The canonical SMILES for 4-methoxyimino-4-thiophen-2-ylbutanoic acid is CON=C(CCC(=O)O)c1cccs1.
What is the InChIKey of 4-methoxyimino-4-thiophen-2-ylbutanoic acid?
The InChIKey is HQDSHTLDFCGASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c1-13-10-7(4-5-9(11)12)8-3-2-6-14-8/h2-3,6H,4-5H2,1H3,(H,11,12).
What are the key properties of 4-methoxyimino-4-thiophen-2-ylbutanoic acid?
4-methoxyimino-4-thiophen-2-ylbutanoic acid has a molecular weight of 213.26 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyimino-4-thiophen-2-ylbutanoic acid is sourced from PubChem (CID 4064427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).