C19H22N4OS — CID 40645621
N'-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 40645621) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is N'-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 40645621 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N'-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(-n2c(C)cc(-c3csc(N=CN(C)C)n3)c2C)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-13-10-17(18-11-25-19(21-18)20-12-22(3)4)14(2)23(13)15-6-8-16(24-5)9-7-15/h6-12H,1-5H3 |
| InChIKey | RVUHAPGKYJAVSP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|