About [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone
[(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 40646327) has the molecular formula C10H10F4N4O2
and a molecular weight of 294.21 g/mol. Its IUPAC name is [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone |
| PubChem CID | 40646327 |
| Molecular Formula | C10H10F4N4O2 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1N=C(C(F)F)C[C@]1(O)C(F)F |
| InChI | InChI=1S/C10H10F4N4O2/c1-17-6(2-3-15-17)8(19)18-10(20,9(13)14)4-5(16-18)7(11)12/h2-3,7,9,20H,4H2,1H3/t10-/m0/s1 |
| InChIKey | BXPIPMQFBMKRMY-JTQLQIEISA-N |
| XLogP | 0.84 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone?
The IUPAC name of [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone (CID 40646327) is [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone.
What is the SMILES notation for [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone?
The canonical SMILES for [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone is Cn1nccc1C(=O)N1N=C(C(F)F)C[C@]1(O)C(F)F.
What is the InChIKey of [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone?
The InChIKey is BXPIPMQFBMKRMY-JTQLQIEISA-N. The full InChI is InChI=1S/C10H10F4N4O2/c1-17-6(2-3-15-17)8(19)18-10(20,9(13)14)4-5(16-18)7(11)12/h2-3,7,9,20H,4H2,1H3/t10-/m0/s1.
What are the key properties of [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone?
[(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone has a molecular weight of 294.21 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-(2-methylpyrazol-3-yl)methanone is sourced from PubChem (CID 40646327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).