About 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid
6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid (PubChem CID 4064758) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid |
| PubChem CID | 4064758 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(=O)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H18N2O5/c19-12(20)8-2-1-5-9-17-16(23)14(21)13-10-6-3-4-7-11(10)18-15(13)22/h3-4,6-7,13H,1-2,5,8-9H2,(H,17,23)(H,18,22)(H,19,20) |
| InChIKey | GUDLQILZULCIHU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid?
The IUPAC name of 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid (CID 4064758) is 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid.
What is the SMILES notation for 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid?
The canonical SMILES for 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid is O=C(O)CCCCCNC(=O)C(=O)C1C(=O)Nc2ccccc21.
What is the InChIKey of 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid?
The InChIKey is GUDLQILZULCIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c19-12(20)8-2-1-5-9-17-16(23)14(21)13-10-6-3-4-7-11(10)18-15(13)22/h3-4,6-7,13H,1-2,5,8-9H2,(H,17,23)(H,18,22)(H,19,20).
What are the key properties of 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid?
6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid has a molecular weight of 318.33 g/mol, XLogP of 1.05, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-oxo-2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]hexanoic acid is sourced from PubChem (CID 4064758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).