C16H16ClNO2 — CID 40648027
3-chloro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]benzamide (PubChem CID 40648027) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 40648027 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-chloro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(Cl)c1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2/c1-11(15(19)12-6-3-2-4-7-12)18-16(20)13-8-5-9-14(17)10-13/h2-11,15,19H,1H3,(H,18,20)/t11-,15+/m1/s1 |
| InChIKey | RCKICHBZNYAKSC-ABAIWWIYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |