C25H19N3O3S — CID 4064819
N-(1,3-benzothiazol-2-yl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 4064819) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4064819 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3nc4ccccc4s3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C25H19N3O3S/c1-30-21-12-11-15(13-22(21)31-2)20-14-17(16-7-3-4-8-18(16)26-20)24(29)28-25-27-19-9-5-6-10-23(19)32-25/h3-14H,1-2H3,(H,27,28,29) |
| InChIKey | AQNITUOZPRWBTF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |