C14H12N2S — CID 40650711
(2S)-2,5-diphenyl-2,3-dihydro-1,3,4-thiadiazole (PubChem CID 40650711) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is (2S)-2,5-diphenyl-2,3-dihydro-1,3,4-thiadiazole.
| Compound Name | (2S)-2,5-diphenyl-2,3-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 40650711 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2S)-2,5-diphenyl-2,3-dihydro-1,3,4-thiadiazole |
| SMILES | c1ccc(C2=NN[C@H](c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C14H12N2S/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12/h1-10,13,15H/t13-/m0/s1 |
| InChIKey | MRNSNACRABGADQ-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |