C15H11F2NO3 — CID 40652964
methyl 3-[(2,4-difluorobenzoyl)amino]benzoate (PubChem CID 40652964) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is methyl 3-[(2,4-difluorobenzoyl)amino]benzoate.
| Compound Name | methyl 3-[(2,4-difluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 40652964 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 3-[(2,4-difluorobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H11F2NO3/c1-21-15(20)9-3-2-4-11(7-9)18-14(19)12-6-5-10(16)8-13(12)17/h2-8H,1H3,(H,18,19) |
| InChIKey | PFPFITVFRQGZDT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |